CAS 1803588-41-1

Carbamic acid, N-cyclohexyl-, 2-piperidinylmethyl ester, hydrochloride (1:1)

Description:

Carbamic acid, N-cyclohexyl-, 2-piperidinylmethyl ester, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a carbamic acid moiety linked to a cyclohexyl group and a piperidinylmethyl ester. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its biological activity. The presence of the cyclohexyl and piperidine groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their ability to interact with biological targets. The compound may exhibit properties such as moderate to high lipophilicity, which can affect its absorption and distribution in biological systems. Additionally, the hydrochloride form indicates that it may be stable under various conditions, making it suitable for laboratory and industrial applications. As with many carbamate derivatives, it may also possess neuroactive properties, warranting careful handling and study regarding its pharmacological effects and safety profile.

Formula: C₁₃H₂₄N₂O₂·ClH

InChI: InChI=1S/C13H24N2O2.ClH/c16-13(15-11-6-2-1-3-7-11)17-10-12-8-4-5-9-14-12;/h11-12,14H,1-10H2,(H,15,16);1H

InChI key: InChIKey=DVIZROJSSWESDT-UHFFFAOYSA-N

SMILES: N(C(OCC1CCCCN1)=O)C2CCCCC2.Cl

Synonyms:

• Carbamic acid, N-cyclohexyl-, 2-piperidinylmethyl ester, hydrochloride (1:1)
• Piperidin-2-ylmethyl N-cyclohexylcarbamate hydrochloride

Piperidin-2-ylmethyl N-cyclohexylcarbamate hydrochloride

CAS: 1803588-41-1

Versatile small molecule scaffold

Formula: C₁₃H₂₅ClN₂O₂

Purity: Min. 95%

Molecular weight: 276.8 g/mol

Ref: 3D-DXC58841