CAS 1803588-43-3

1,2,4-Triazolo[4,3-a]pyrazine, 3-(5-bromo-3-pyridinyl)-5,6,7,8-tetrahydro-, hydrochloride (1:3)

Description:

1,2,4-Triazolo[4,3-a]pyrazine, 3-(5-bromo-3-pyridinyl)-5,6,7,8-tetrahydro-, hydrochloride (1:3) is a complex organic compound characterized by its unique bicyclic structure, which incorporates both triazole and pyrazine moieties. This compound typically exhibits properties such as solubility in polar solvents due to the presence of the hydrochloride salt form, which enhances its stability and bioavailability. The bromine substituent on the pyridine ring can influence its electronic properties and reactivity, making it a potential candidate for various applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's molecular structure suggests potential interactions with biological targets, which may lead to pharmacological activities. Additionally, the presence of multiple heteroatoms in its structure can contribute to its ability to form hydrogen bonds, impacting its interactions in biological systems. Overall, this compound represents a class of heterocyclic compounds that are of significant interest in drug discovery and development.

Formula: C₁₀H₁₀BrN₅·3ClH

InChI: InChI=1S/C10H10BrN5.3ClH/c11-8-3-7(4-13-5-8)10-15-14-9-6-12-1-2-16(9)10;;;/h3-5,12H,1-2,6H2;3*1H

InChI key: InChIKey=FNJAPWIYOAWMCF-UHFFFAOYSA-N

SMILES: BrC1=CC(C=2N3C(=NN2)CNCC3)=CN=C1.Cl

Synonyms:

• 3-Bromo-5-[5H,6H,7H,8H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]pyridine trihydrochloride
• 1,2,4-Triazolo[4,3-a]pyrazine, 3-(5-bromo-3-pyridinyl)-5,6,7,8-tetrahydro-, hydrochloride (1:3)

3-Bromo-5-{5H,6H,7H,8H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl}pyridine trihydrochloride

CAS: 1803588-43-3

Versatile small molecule scaffold

Formula: C₁₀H₁₃BrCl₃N₅

Purity: Min. 95%

Molecular weight: 389.5 g/mol

Ref: 3D-DXC58843