CAS 1803588-44-4

2-Furancarboxylic acid, 5-[(methylamino)methyl]-, methyl ester, hydrochloride (1:1)

Description:

2-Furancarboxylic acid, 5-[(methylamino)methyl]-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. This compound features a carboxylic acid functional group and a methyl ester, indicating it has both acidic and ester functionalities. The presence of a methylamino group suggests it has basic properties, which are further enhanced by the hydrochloride salt form, making it soluble in water and suitable for various applications in pharmaceuticals and organic synthesis. The compound's molecular structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. Its hydrochloride form typically enhances stability and solubility, which is advantageous for drug formulation. Overall, this compound's unique combination of functional groups and structural characteristics positions it as a versatile intermediate in chemical synthesis and potential therapeutic applications.

Formula: C₈H₁₁NO₃·ClH

InChI: InChI=1S/C8H11NO3.ClH/c1-9-5-6-3-4-7(12-6)8(10)11-2;/h3-4,9H,5H2,1-2H3;1H

InChI key: InChIKey=OSWDIEIVJJMNEQ-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1OC(CNC)=CC1.Cl

Synonyms:

• 2-Furancarboxylic acid, 5-[(methylamino)methyl]-, methyl ester, hydrochloride (1:1)

Methyl 5-[(methylamino)methyl]furan-2-carboxylate hydrochloride

CAS: 1803588-44-4

Versatile small molecule scaffold

Formula: C₈H₁₂ClNO₃

Purity: Min. 95%

Molecular weight: 205.64 g/mol

Ref: 3D-DXC58844