CAS 1803588-83-1

Pyrrolidine, 1-[4-(bromomethyl)phenyl]-, hydrobromide (1:1)

Description:

Pyrrolidine, 1-[4-(bromomethyl)phenyl]-, hydrobromide (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated nitrogen-containing heterocycle. The presence of a bromomethyl group attached to a phenyl ring indicates that this compound has potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. The hydrobromide salt form suggests that it is a stable ionic compound, enhancing its solubility in polar solvents, which is advantageous for various chemical reactions and biological applications. The compound's structure may impart specific pharmacological properties, making it of interest for research in drug development. Additionally, the presence of the bromine atom can facilitate further chemical modifications, allowing for the exploration of structure-activity relationships. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks or environmental hazards. Overall, this compound exemplifies the intersection of organic chemistry and medicinal applications.

Formula: C₁₁H₁₄BrN·BrH

InChI: InChI=1S/C11H14BrN.BrH/c12-9-10-3-5-11(6-4-10)13-7-1-2-8-13;/h3-6H,1-2,7-9H2;1H

InChI key: InChIKey=WGTZAPPKWFXKLS-UHFFFAOYSA-N

SMILES: C(Br)C1=CC=C(C=C1)N2CCCC2.Br

Synonyms:

• Pyrrolidine, 1-[4-(bromomethyl)phenyl]-, hydrobromide (1:1)

1-[4-(Bromomethyl)phenyl]pyrrolidine hydrobromide

CAS: 1803588-83-1

Versatile small molecule scaffold

Formula: C₁₁H₁₅Br₂N

Purity: Min. 95%

Molecular weight: 321.05 g/mol

Ref: 3D-DXC58883