CAS 1803588-96-6

1H-1,2,3-Triazole-4-methanamine, 1-(3-bromophenyl)-N-methyl-, hydrochloride (1:1)

Description:

1H-1,2,3-Triazole-4-methanamine, 1-(3-bromophenyl)-N-methyl-, hydrochloride (1:1) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This compound features a bromophenyl group, contributing to its potential biological activity and reactivity. The presence of the N-methyl group indicates that it has a tertiary amine, which can influence its solubility and interaction with biological systems. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it easier to handle in laboratory settings. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific applications and effects would depend on further studies, including its mechanism of action and potential therapeutic uses. Safety data and handling precautions should be considered, as with any chemical substance, particularly those with halogen substituents like bromine, which can impart unique reactivity and toxicity profiles.

Formula: C₁₀H₁₁BrN₄·ClH

InChI: InChI=1S/C10H11BrN4.ClH/c1-12-6-9-7-15(14-13-9)10-4-2-3-8(11)5-10;/h2-5,7,12H,6H2,1H3;1H

InChI key: InChIKey=MYUIINBCWICOIE-UHFFFAOYSA-N

SMILES: C(NC)C1=CN(N=N1)C2=CC(Br)=CC=C2.Cl

Synonyms:

• 1H-1,2,3-Triazole-4-methanamine, 1-(3-bromophenyl)-N-methyl-, hydrochloride (1:1)

{[1-(3-Bromophenyl)-1H-1,2,3-triazol-4-yl]methyl}(methyl)amine hydrochloride

CAS: 1803588-96-6

Versatile small molecule scaffold

Formula: C₁₀H₁₂BrClN₄

Purity: Min. 95%

Molecular weight: 303.58 g/mol

Ref: 3D-DXC58896