CAS 1803589-55-0

Cyclobutaneethanol, β-[[(phenylmethyl)amino]methyl]-

Description:

Cyclobutaneethanol, β-[[(phenylmethyl)amino]methyl]- is a chemical compound characterized by its unique structure, which includes a cyclobutane ring and an ethanol moiety. The presence of the phenylmethylamino group suggests that it may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its specific form and purity. Its molecular structure may impart interesting reactivity, particularly in organic synthesis, where it could serve as a building block or intermediate. The presence of both cyclic and linear components in its structure may influence its physical properties, such as boiling point and solubility in various solvents. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. However, specific safety and handling information should be consulted, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₄H₂₁NO

InChI: InChI=1S/C14H21NO/c16-11-14(13-7-4-8-13)10-15-9-12-5-2-1-3-6-12/h1-3,5-6,13-16H,4,7-11H2

InChI key: InChIKey=AWOGZSFUBQHNIB-UHFFFAOYSA-N

SMILES: C(CNCC1=CC=CC=C1)(CO)C2CCC2

Synonyms:

• β-[[(Phenylmethyl)amino]methyl]cyclobutaneethanol
• Cyclobutaneethanol, β-[[(phenylmethyl)amino]methyl]-

3-(Benzylamino)-2-cyclobutylpropan-1-ol

CAS: 1803589-55-0

Versatile small molecule scaffold

Formula: C₁₄H₂₁NO

Purity: Min. 95%

Molecular weight: 219.32 g/mol

Ref: 3D-DXC58955