CAS 1803590-35-3

1H-Pyrazole-4-methanamine, 5-chloro-N,1,3-trimethyl-, hydrochloride (1:2)

Description:

1H-Pyrazole-4-methanamine, 5-chloro-N,1,3-trimethyl-, hydrochloride (1:2) is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a methanamine group indicates an amine functional group, contributing to its basicity and potential reactivity. The compound features a chlorine substituent at the 5-position of the pyrazole ring, which can influence its biological activity and solubility. The trimethyl groups attached to the nitrogen atoms enhance its steric properties and may affect its interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in various applications, including pharmaceuticals. The compound's specific properties, such as melting point, solubility, and reactivity, would depend on its molecular structure and the presence of functional groups. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development.

Formula: C₇H₁₂ClN₃·2ClH

InChI: InChI=1S/C7H12ClN3.2ClH/c1-5-6(4-9-2)7(8)11(3)10-5;;/h9H,4H2,1-3H3;2*1H

InChI key: InChIKey=WBVLROTUJCZCPI-UHFFFAOYSA-N

SMILES: C(NC)C1=C(Cl)N(C)N=C1C.Cl

Synonyms:

• 1H-Pyrazole-4-methanamine, 5-chloro-N,1,3-trimethyl-, hydrochloride (1:2)

[(5-Chloro-1,3-dimethyl-1H-pyrazol-4-yl)methyl](methyl)amine dihydrochloride

CAS: 1803590-35-3

Versatile small molecule scaffold

Formula: C₇H₁₄Cl₃N₃

Purity: Min. 95%

Molecular weight: 246.6 g/mol

Ref: 3D-DXC59035