CAS 1803590-38-6

1H-1,2,4-Triazole-3-carbonitrile, 1-(4-piperidinyl)-, hydrochloride (1:1)

Description:

1H-1,2,4-Triazole-3-carbonitrile, 1-(4-piperidinyl)-, hydrochloride (1:1) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a carbonitrile group, contributing to its potential reactivity and biological activity. The presence of a piperidine moiety enhances its pharmacological properties, making it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various applications, including pharmaceuticals. The compound may exhibit properties such as antimicrobial, antifungal, or anticancer activities, although specific biological effects would depend on its structural nuances and the context of its use. Its CAS number, 1803590-38-6, allows for precise identification in chemical databases. Safety and handling considerations are essential, as with many nitrogen-containing heterocycles, due to potential toxicity or reactivity. Overall, this compound represents a significant area of interest for research and development in drug discovery and related fields.

Formula: C₈H₁₁N₅·ClH

InChI: InChI=1S/C8H11N5.ClH/c9-5-8-11-6-13(12-8)7-1-3-10-4-2-7;/h6-7,10H,1-4H2;1H

InChI key: InChIKey=TVCIOQUMVAOUOU-UHFFFAOYSA-N

SMILES: C(#N)C1=NN(C=N1)C2CCNCC2.Cl

Synonyms:

• 1H-1,2,4-Triazole-3-carbonitrile, 1-(4-piperidinyl)-, hydrochloride (1:1)

1-(Piperidin-4-yl)-1H-1,2,4-triazole-3-carbonitrile hydrochloride

CAS: 1803590-38-6

Versatile small molecule scaffold

Formula: C₈H₁₂ClN₅

Purity: Min. 95%

Molecular weight: 213.67 g/mol

Ref: 3D-DXC59038