CAS 1803590-53-5

2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-4-hexyn-3-one

Description:

2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-4-hexyn-3-one is an organosilicon compound characterized by its unique structure, which includes a siloxy group and a terminal alkyne. The presence of the dimethylsilyl group imparts hydrophobic properties, making the compound less soluble in water but more soluble in organic solvents. This compound typically exhibits a moderate boiling point and melting point, influenced by its molecular weight and functional groups. The alkyne functional group contributes to its reactivity, allowing for potential participation in various chemical reactions, such as nucleophilic additions or coupling reactions. Additionally, the presence of the ketone functional group (3-one) suggests that it may undergo typical carbonyl chemistry, including oxidation and reduction reactions. Overall, this compound's unique combination of siloxy and alkyne functionalities makes it a valuable intermediate in organic synthesis and materials science, particularly in the development of siloxane-based polymers and other advanced materials.

Formula: C₁₂H₂₂O₂Si

InChI: InChI=1S/C12H22O2Si/c1-8-9-11(13)10(2)14-15(6,7)12(3,4)5/h10H,1-7H3

InChI key: InChIKey=WHLAMDQNZQFMLM-UHFFFAOYSA-N

SMILES: [Si](OC(C(C#CC)=O)C)(C(C)(C)C)(C)C

Synonyms:

• 2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-4-hexyn-3-one
• 4-Hexyn-3-one, 2-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-

2-[(tert-Butyldimethylsilyl)oxy]hex-4-yn-3-one

CAS: 1803590-53-5

Versatile small molecule scaffold

Formula: C₁₂H₂₂O₂Si

Purity: Min. 95%

Molecular weight: 226.39 g/mol

Ref: 3D-DXC59053