CAS 1803590-58-0

4-Isothiazolamine, 3,5-dimethyl-, hydrochloride (1:1)

Description:

4-Isothiazolamine, 3,5-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its isothiazole ring structure, which contributes to its biological activity. This compound typically appears as a white to off-white crystalline solid and is soluble in water, indicating its potential for various applications in pharmaceuticals and agrochemicals. The presence of the isothiazole moiety suggests that it may exhibit antimicrobial or antifungal properties, making it of interest in medicinal chemistry. The hydrochloride form indicates that it is a salt, which can enhance its stability and solubility in aqueous solutions. As with many isothiazole derivatives, it may also possess a range of functional groups that can participate in chemical reactions, allowing for further derivatization. Safety and handling precautions are essential, as with any chemical substance, due to potential toxicity or reactivity. Overall, 4-Isothiazolamine, 3,5-dimethyl-, hydrochloride (1:1) is a compound of interest for research and development in various chemical and biological fields.

Formula: C₅H₈N₂S·ClH

InChI: InChI=1S/C5H8N2S.ClH/c1-3-5(6)4(2)8-7-3;/h6H2,1-2H3;1H

InChI key: InChIKey=TUWZLOCJYUHJLP-UHFFFAOYSA-N

SMILES: NC=1C(C)=NSC1C.Cl

Synonyms:

• 4-Isothiazolamine, 3,5-dimethyl-, hydrochloride (1:1)

Dimethyl-1,2-thiazol-4-amine hydrochloride

CAS: 1803590-58-0

Versatile small molecule scaffold

Formula: C₅H₉ClN₂S

Purity: Min. 95%

Molecular weight: 164.66 g/mol

Ref: 3D-DXC59058