CAS 1803590-59-1

1H-Pyrrole-3-methanamine, 1-ethyl-, hydrochloride (1:1)

Description:

1H-Pyrrole-3-methanamine, 1-ethyl-, hydrochloride (1:1) is a chemical compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing one nitrogen atom. This compound features an ethyl group attached to the nitrogen of the pyrrole, along with a methanamine functional group, contributing to its basicity and potential reactivity. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The presence of the hydrochloride also suggests that it may exhibit improved stability and bioavailability compared to its free base form. As with many nitrogen-containing heterocycles, this compound may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Its unique structure and properties make it of interest in medicinal chemistry and materials science, although specific applications would depend on further research and development.

Formula: C₇H₁₂N₂·ClH

InChI: InChI=1S/C7H12N2.ClH/c1-2-9-4-3-7(5-8)6-9;/h3-4,6H,2,5,8H2,1H3;1H

InChI key: InChIKey=WJHCBVQQXKJWOP-UHFFFAOYSA-N

SMILES: C(N)C1=CN(CC)C=C1.Cl

Synonyms:

• 1H-Pyrrole-3-methanamine, 1-ethyl-, hydrochloride (1:1)

(1-Ethyl-1H-pyrrol-3-yl)methanamine hydrochloride

CAS: 1803590-59-1

Versatile small molecule scaffold

Formula: C₇H₁₃ClN₂

Purity: Min. 95%

Molecular weight: 160.64 g/mol

Ref: 3D-DXC59059