CAS 1803590-78-4

5-Fluoro-4-formyl-2-nitrobenzonitrile

Description:

5-Fluoro-4-formyl-2-nitrobenzonitrile is an organic compound characterized by its complex aromatic structure, which includes a fluorine atom, a formyl group, and a nitro group attached to a benzonitrile framework. The presence of the fluorine atom typically enhances the compound's reactivity and lipophilicity, making it of interest in medicinal chemistry and material science. The formyl group (-CHO) contributes to its potential as an intermediate in organic synthesis, while the nitro group (-NO2) can influence the compound's electronic properties and reactivity. This compound is likely to exhibit polar characteristics due to the presence of both the formyl and nitro groups, which can engage in hydrogen bonding and dipole interactions. Additionally, its nitrile group (-C≡N) may impart unique properties such as increased stability and the ability to participate in nucleophilic reactions. Overall, 5-Fluoro-4-formyl-2-nitrobenzonitrile is a versatile compound with potential applications in pharmaceuticals and agrochemicals, although specific handling and safety measures should be observed due to its reactive functional groups.

Formula: C₈H₃FN₂O₃

InChI: InChI=1S/C8H3FN2O3/c9-7-1-5(3-10)8(11(13)14)2-6(7)4-12/h1-2,4H

InChI key: InChIKey=RXSZJISAUBWFMS-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(C#N)C=C(F)C(C=O)=C1

Synonyms:

• Benzonitrile, 5-fluoro-4-formyl-2-nitro-
• 5-Fluoro-4-formyl-2-nitrobenzonitrile

5-Fluoro-4-formyl-2-nitrobenzonitrile

CAS: 1803590-78-4

Versatile small molecule scaffold

Formula: C₈H₃FN₂O₃

Purity: Min. 95%

Molecular weight: 194.12 g/mol

Ref: 3D-DXC59078