CAS 1803590-84-2

1,1-Dimethylethyl N-[2-formyl-3-(4-pyridinyl)propyl]carbamate

Description:

1,1-Dimethylethyl N-[2-formyl-3-(4-pyridinyl)propyl]carbamate, identified by its CAS number 1803590-84-2, is a chemical compound that features a carbamate functional group, which is characterized by the presence of a carbonyl group (C=O) bonded to a nitrogen atom (N) that is also connected to an alkyl or aryl group. This compound includes a dimethyl group, indicating the presence of two methyl groups attached to a tertiary carbon, contributing to its steric bulk. The structure also contains a pyridine ring, which is a six-membered aromatic ring with one nitrogen atom, enhancing its potential for biological activity and interactions. The formyl group suggests the presence of an aldehyde functionality, which can participate in various chemical reactions, including condensation and oxidation. Overall, this compound may exhibit interesting properties due to its unique structural features, making it a candidate for applications in medicinal chemistry or as a potential ligand in coordination chemistry.

Formula: C₁₄H₂₀N₂O₃

InChI: InChI=1S/C14H20N2O3/c1-14(2,3)19-13(18)16-9-12(10-17)8-11-4-6-15-7-5-11/h4-7,10,12H,8-9H2,1-3H3,(H,16,18)

InChI key: InChIKey=MTBLPAHUPOLEHE-UHFFFAOYSA-N

SMILES: C(C(CNC(OC(C)(C)C)=O)C=O)C=1C=CN=CC1

Synonyms:

• tert-Butyl N-[3-oxo-2-[(pyridin-4-yl)methyl]propyl]carbamate
• Carbamic acid, N-[2-formyl-3-(4-pyridinyl)propyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[2-formyl-3-(4-pyridinyl)propyl]carbamate

tert-Butyl N-[3-oxo-2-(pyridin-4-ylmethyl)propyl]carbamate

CAS: 1803590-84-2

Versatile small molecule scaffold

Formula: C₁₄H₂₀N₂O₃

Purity: Min. 95%

Molecular weight: 264.32 g/mol

Ref: 3D-DXC59084