CAS 1803590-97-7

Pyrrolidine, 2-cyclopropyl-2-(methoxymethyl)-, hydrochloride (1:1)

Description:

Pyrrolidine, 2-cyclopropyl-2-(methoxymethyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated nitrogen-containing heterocycle. The presence of a cyclopropyl group and a methoxymethyl substituent contributes to its unique properties and potential reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its bioavailability in pharmaceutical applications. The compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, and it may be studied for its pharmacological effects. Safety and handling precautions are essential, as with any chemical substance, particularly those with unknown toxicity profiles. Overall, this compound represents a specific class of organic molecules that may have applications in drug development or other chemical research fields.

Formula: C₉H₁₇NO·ClH

InChI: InChI=1S/C9H17NO.ClH/c1-11-7-9(8-3-4-8)5-2-6-10-9;/h8,10H,2-7H2,1H3;1H

InChI key: InChIKey=DOESLHIJWUZDQZ-UHFFFAOYSA-N

SMILES: C(OC)C1(CCCN1)C2CC2.Cl

Synonyms:

• Pyrrolidine, 2-cyclopropyl-2-(methoxymethyl)-, hydrochloride (1:1)

2-Cyclopropyl-2-(methoxymethyl)pyrrolidine hydrochloride

CAS: 1803590-97-7

Versatile small molecule scaffold

Formula: C₉H₁₈ClNO

Purity: Min. 95%

Molecular weight: 191.7 g/mol

Ref: 3D-DXC59097