CAS 1803590-99-9

1-Azetidineacetic acid, 3-methyl-, hydrochloride (1:1)

Description:

1-Azetidineacetic acid, 3-methyl-, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocyclic compound containing one nitrogen atom. This compound features a carboxylic acid functional group, contributing to its acidic properties, and a methyl group at the third position of the azetidine ring, which influences its steric and electronic characteristics. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it more stable for storage and handling. Typically, such compounds may exhibit biological activity, potentially serving as intermediates in pharmaceutical synthesis or as active pharmaceutical ingredients. The presence of the azetidine ring may also suggest potential applications in medicinal chemistry, particularly in the development of drugs targeting neurological or metabolic pathways. As with all chemical substances, safety data sheets should be consulted for handling and toxicity information.

Formula: C₆H₁₁NO₂·ClH

InChI: InChI=1S/C6H11NO2.ClH/c1-5-2-7(3-5)4-6(8)9;/h5H,2-4H2,1H3,(H,8,9);1H

InChI key: InChIKey=DMYJJZXKJKOVAG-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1CC(C)C1.Cl

Synonyms:

• 1-Azetidineacetic acid, 3-methyl-, hydrochloride (1:1)

2-(3-Methylazetidin-1-yl)acetic acid hydrochloride

CAS: 1803590-99-9

Versatile small molecule scaffold

Formula: C₆H₁₂ClNO₂

Purity: Min. 95%

Molecular weight: 165.62 g/mol

Ref: 3D-DXC59099