CAS 1803591-12-9

Glycine, N-(2,2-difluoroethyl)-, methyl ester, hydrochloride (1:1)

Description:

Glycine, N-(2,2-difluoroethyl)-, methyl ester, hydrochloride (1:1) is a synthetic compound that belongs to the class of amino acid derivatives. It features a glycine backbone, which is the simplest amino acid, modified with a difluoroethyl group and a methyl ester functional group. The presence of the hydrochloride indicates that it is a salt form, enhancing its solubility in water and making it suitable for various applications, including pharmaceutical research. The difluoroethyl substituent may impart unique biological properties, potentially influencing the compound's interaction with biological targets. This compound is likely to be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Its molecular structure suggests it may exhibit specific reactivity patterns and biological activities, which would be important for further studies. As with many chemical substances, safety data and handling precautions should be considered, especially due to the presence of fluorine, which can affect toxicity and environmental impact.

Formula: C₅H₉F₂NO₂·ClH

InChI: InChI=1S/C5H9F2NO2.ClH/c1-10-5(9)3-8-2-4(6)7;/h4,8H,2-3H2,1H3;1H

InChI key: InChIKey=OLPNEKSQHIXKQB-UHFFFAOYSA-N

SMILES: C(CNCC(F)F)(OC)=O.Cl

Synonyms:

• Glycine, N-(2,2-difluoroethyl)-, methyl ester, hydrochloride (1:1)

Methyl 2-[(2,2-difluoroethyl)amino]acetate hydrochloride

CAS: 1803591-12-9

Versatile small molecule scaffold

Formula: C₅H₁₀ClF₂NO₂

Purity: Min. 95%

Molecular weight: 189.59 g/mol

Ref: 3D-DXC59112