CAS 1803591-14-1

Acetamide, N-(4-aminocyclohexyl)-, hydrochloride (1:1)

Description:

Acetamide, N-(4-aminocyclohexyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from acetic acid and contains a cyclohexyl ring substituted with an amino group. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The presence of the amino group suggests potential basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Its structure indicates that it may exhibit biological activity, making it of interest in pharmaceutical research. The compound's CAS number, 1803591-14-1, allows for precise identification in chemical databases. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed. Overall, this compound's unique structure and properties may contribute to its applications in medicinal chemistry and related fields.

Formula: C₈H₁₆N₂O·ClH

InChI: InChI=1S/C8H16N2O.ClH/c1-6(11)10-8-4-2-7(9)3-5-8;/h7-8H,2-5,9H2,1H3,(H,10,11);1H

InChI key: InChIKey=SNAKODNYSNFMPS-UHFFFAOYSA-N

SMILES: N(C(C)=O)C1CCC(N)CC1.Cl

Synonyms:

• Acetamide, N-(4-aminocyclohexyl)-, hydrochloride (1:1)

N-(4-Aminocyclohexyl)acetamide hydrochloride

CAS: 1803591-14-1

Versatile small molecule scaffold

Formula: C₈H₁₇ClN₂O

Purity: Min. 95%

Molecular weight: 192.68 g/mol

Ref: 3D-DXC59114