CAS 1803591-20-9

Ethyl 6-(chlorosulfonyl)[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate

Description:

Ethyl 6-(chlorosulfonyl)[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate is a chemical compound characterized by its unique structure, which includes a triazole ring fused to a pyrimidine moiety. This compound features a chlorosulfonyl group, which is known for its reactivity and potential to participate in various chemical reactions, including nucleophilic substitutions. The ethyl ester functional group contributes to its solubility and reactivity, making it a useful intermediate in organic synthesis. The presence of the triazole and pyrimidine rings suggests potential biological activity, as these structures are often found in pharmaceuticals and agrochemicals. Additionally, the compound's specific functional groups may impart properties such as increased lipophilicity or enhanced interaction with biological targets. Overall, Ethyl 6-(chlorosulfonyl)[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate is of interest in medicinal chemistry and materials science due to its structural features and potential applications.

Formula: C₈H₇ClN₄O₄S

InChI: InChI=1S/C8H7ClN4O4S/c1-2-17-7(14)6-11-8-10-3-5(18(9,15)16)4-13(8)12-6/h3-4H,2H2,1H3

InChI key: InChIKey=FAADPSSFFKLRJR-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=NN2C(=N1)N=CC(S(Cl)(=O)=O)=C2

Synonyms:

• [1,2,4]Triazolo[1,5-a]pyrimidine-2-carboxylic acid, 6-(chlorosulfonyl)-, ethyl ester
• Ethyl 6-(chlorosulfonyl)[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate

Ethyl 6-(chlorosulfonyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate

CAS: 1803591-20-9

Versatile small molecule scaffold

Formula: C₈H₇ClN₄O₄S

Purity: Min. 95%

Molecular weight: 290.68 g/mol

Ref: 3D-DXC59120