CAS 1803591-34-5

Azetidine, 3-(2-bromoethyl)-1-methyl-, hydrobromide (1:1)

Description:

Azetidine, 3-(2-bromoethyl)-1-methyl-, hydrobromide (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of a bromoethyl group at the 3-position of the azetidine ring introduces a halogen substituent, which can influence the compound's reactivity and potential applications in organic synthesis or medicinal chemistry. The hydrobromide salt form indicates that the compound is protonated, enhancing its solubility in polar solvents and potentially affecting its biological activity. This compound may exhibit properties typical of azetidine derivatives, such as being a potential building block in drug development or serving as an intermediate in the synthesis of more complex molecules. Its specific characteristics, including melting point, boiling point, and spectral data, would be determined through experimental methods and are essential for understanding its behavior in various chemical contexts. Safety data should also be consulted, as halogenated compounds can pose health risks.

Formula: C₆H₁₂BrN·BrH

InChI: InChI=1S/C6H12BrN.BrH/c1-8-4-6(5-8)2-3-7;/h6H,2-5H2,1H3;1H

InChI key: InChIKey=WVOUFLMBKRTWOZ-UHFFFAOYSA-N

SMILES: C(CBr)C1CN(C)C1.Br

Synonyms:

• Azetidine, 3-(2-bromoethyl)-1-methyl-, hydrobromide (1:1)

3-(2-Bromoethyl)-1-methylazetidine hydrobromide

CAS: 1803591-34-5

Versatile small molecule scaffold

Formula: C₆H₁₃Br₂N

Purity: Min. 95%

Molecular weight: 258.98 g/mol

Ref: 3D-DXC59134