CAS 1803591-35-6

Phenol, 2-amino-5-(trifluoromethoxy)-, hydrochloride (1:1)

Description:

Phenol, 2-amino-5-(trifluoromethoxy)-, hydrochloride (1:1) is a chemical compound characterized by its phenolic structure, which includes an amino group and a trifluoromethoxy substituent. The presence of the amino group contributes to its basicity and potential for forming hydrogen bonds, while the trifluoromethoxy group enhances its lipophilicity and may influence its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in various applications, including pharmaceuticals and agrochemicals. The compound may exhibit specific biological properties, making it of interest in medicinal chemistry. Its molecular interactions can be influenced by the trifluoromethoxy group, which can affect the compound's overall polarity and electronic properties. Safety data and handling precautions should be observed, as with any chemical, particularly those with potential biological activity.

Formula: C₇H₆F₃NO₂·ClH

InChI: InChI=1S/C7H6F3NO2.ClH/c8-7(9,10)13-4-1-2-5(11)6(12)3-4;/h1-3,12H,11H2;1H

InChI key: InChIKey=FKGGREQNDBXTCK-UHFFFAOYSA-N

SMILES: O(C(F)(F)F)C1=CC(O)=C(N)C=C1.Cl

Synonyms:

• Phenol, 2-amino-5-(trifluoromethoxy)-, hydrochloride (1:1)

2-Amino-5-(trifluoromethoxy)phenol hydrochloride

CAS: 1803591-35-6

Versatile small molecule scaffold

Formula: C₇H₇ClF₃NO₂

Purity: Min. 95%

Molecular weight: 229.58 g/mol

Ref: 3D-DXC59135