CAS 1803591-43-6

2H-Thiopyran-4-acetic acid, 4-(aminomethyl)tetrahydro-, 1,1-dioxide, hydrochloride (1:1)

Description:

2H-Thiopyran-4-acetic acid, 4-(aminomethyl)tetrahydro-, 1,1-dioxide, hydrochloride (1:1) is a chemical compound characterized by its unique thiopyran ring structure, which incorporates a sulfur atom within a six-membered ring. This compound features an acetic acid moiety and an aminomethyl group, contributing to its potential biological activity. The presence of the 1,1-dioxide indicates that it has two oxygen atoms double-bonded to the sulfur atom, which can influence its reactivity and solubility. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific interactions and mechanisms of action would depend on its structural characteristics and the functional groups present. Overall, this compound represents a class of thiopyran derivatives that may have potential therapeutic applications, warranting further investigation into its biological effects and mechanisms.

Formula: C₈H₁₅NO₄S·ClH

InChI: InChI=1S/C8H15NO4S.ClH/c9-6-8(5-7(10)11)1-3-14(12,13)4-2-8;/h1-6,9H2,(H,10,11);1H

InChI key: InChIKey=ASFKXAJJFFZPMS-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1(CN)CCS(=O)(=O)CC1.Cl

Synonyms:

• 2H-Thiopyran-4-acetic acid, 4-(aminomethyl)tetrahydro-, 1,1-dioxide, hydrochloride (1:1)

2-(4-(Aminomethyl)-1,1-dioxidotetrahydro-2H-thiopyran-4-yl)acetic acid hydrochloride

CAS: 1803591-43-6

Versatile small molecule scaffold

Formula: C₈H₁₆ClNO₄S

Purity: Min. 95%

Molecular weight: 257.74 g/mol

Ref: 3D-DXC59143