CAS 1803591-80-1

5H-Pyrrolo[2,1-c]-1,2,4-triazole-3-ethanamine, 6,7-dihydro-, hydrochloride (1:2)

Description:

5H-Pyrrolo[2,1-c]-1,2,4-triazole-3-ethanamine, 6,7-dihydro-, hydrochloride (1:2) is a chemical compound characterized by its unique bicyclic structure, which incorporates a pyrrole and triazole moiety. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its nitrogen-rich framework. The hydrochloride salt form indicates that it is a protonated version of the base compound, enhancing its solubility in water and making it more suitable for pharmaceutical applications. The presence of the ethanamine group suggests that it may participate in various chemical reactions, including those involving amine functionalities. This compound may be of interest in medicinal chemistry, particularly for its potential therapeutic effects, although specific biological activities would require further investigation. Its CAS number, 1803591-80-1, allows for precise identification in chemical databases, facilitating research and development in various scientific fields. Overall, the compound's structural features and salt form contribute to its potential utility in drug development and other applications.

Formula: C₇H₁₂N₄·2ClH

InChI: InChI=1S/C7H12N4.2ClH/c8-4-3-7-10-9-6-2-1-5-11(6)7;;/h1-5,8H2;2*1H

InChI key: InChIKey=USBYDOHNVSWYEE-UHFFFAOYSA-N

SMILES: C(CN)C=1N2C(=NN1)CCC2.Cl

Synonyms:

• 5H-Pyrrolo[2,1-c]-1,2,4-triazole-3-ethanamine, 6,7-dihydro-, hydrochloride (1:2)

2-{5H,6H,7H-Pyrrolo[2,1-c][1,2,4]triazol-3-yl}ethan-1-amine dihydrochloride

CAS: 1803591-80-1

Versatile small molecule scaffold

Formula: C₇H₁₄Cl₂N₄

Purity: Min. 95%

Molecular weight: 225.12 g/mol

Ref: 3D-DXC59180