CAS 1803591-94-7

1,2,4-Triazolidine-3,5-dione, 4-(3-aminophenyl)-, hydrochloride (1:1)

Description:

1,2,4-Triazolidine-3,5-dione, 4-(3-aminophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its triazolidine ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a dione functional group, indicating the presence of two carbonyl groups, and an amino group attached to a phenyl ring, which contributes to its potential biological activity. The hydrochloride form suggests that the compound is a salt, enhancing its solubility in water and stability. Typically, compounds of this nature may exhibit pharmacological properties, making them of interest in medicinal chemistry. The presence of the amino group can facilitate interactions with biological targets, potentially influencing its efficacy as a therapeutic agent. Additionally, the compound's molecular structure may allow for various chemical modifications, which can be explored for developing derivatives with improved properties. As with many chemical substances, safety data and handling precautions should be considered, especially in laboratory settings.

Formula: C₈H₈N₄O₂·ClH

InChI: InChI=1S/C8H8N4O2.ClH/c9-5-2-1-3-6(4-5)12-7(13)10-11-8(12)14;/h1-4H,9H2,(H,10,13)(H,11,14);1H

InChI key: InChIKey=OWPWKWMYZDKSPV-UHFFFAOYSA-N

SMILES: O=C1N(C2=CC(N)=CC=C2)C(=O)NN1.Cl

Synonyms:

• 1,2,4-Triazolidine-3,5-dione, 4-(3-aminophenyl)-, hydrochloride (1:1)

4-(3-Aminophenyl)-1,2,4-triazolidine-3,5-dione hydrochloride

CAS: 1803591-94-7

Versatile small molecule scaffold

Formula: C₈H₉ClN₄O₂

Purity: Min. 95%

Molecular weight: 228.63 g/mol

Ref: 3D-DXC59194