CAS 1803592-00-8

Acetamide, 2-amino-N-[2-(2-methoxyphenyl)ethyl]-, hydrochloride (1:1)

Description:

Acetamide, 2-amino-N-[2-(2-methoxyphenyl)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is indicative of its potential as a polar molecule. This compound features an amino group, contributing to its basicity and ability to form hydrogen bonds, enhancing its solubility in polar solvents like water. The presence of the methoxyphenyl group adds to its hydrophobic character, influencing its overall solubility and interaction with biological systems. As a hydrochloride salt, it is typically more stable and easier to handle than its free base form, often exhibiting improved solubility in aqueous solutions. This compound may be of interest in pharmaceutical research due to its structural features, which could suggest potential biological activity. Its molecular structure allows for various interactions, making it a candidate for studies in medicinal chemistry, particularly in the development of therapeutic agents. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₁₁H₁₆N₂O₂·ClH

InChI: InChI=1S/C11H16N2O2.ClH/c1-15-10-5-3-2-4-9(10)6-7-13-11(14)8-12;/h2-5H,6-8,12H2,1H3,(H,13,14);1H

InChI key: InChIKey=KGENCZVNJOZDTC-UHFFFAOYSA-N

SMILES: C(CNC(CN)=O)C1=C(OC)C=CC=C1.Cl

Synonyms:

• Acetamide, 2-amino-N-[2-(2-methoxyphenyl)ethyl]-, hydrochloride (1:1)

2-Amino-N-[2-(2-methoxyphenyl)ethyl]acetamide hydrochloride

CAS: 1803592-00-8

Versatile small molecule scaffold

Formula: C₁₁H₁₇ClN₂O₂

Purity: Min. 95%

Molecular weight: 244.72 g/mol

Ref: 3D-DXC59200