CAS 1803592-16-6

3-Piperidinamine, 1-[(4-bromophenyl)sulfonyl]-, hydrochloride (1:1)

Description:

3-Piperidinamine, 1-[(4-bromophenyl)sulfonyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. The compound features a sulfonamide functional group, specifically a sulfonyl group attached to a 4-bromophenyl moiety, indicating the presence of a bromine atom on the phenyl ring. This structure contributes to its potential biological activity, particularly in medicinal chemistry, where sulfonamides are often explored for their antibacterial and antitumor properties. The hydrochloride salt form indicates that the compound is protonated, enhancing its solubility in water and making it suitable for various applications, including pharmaceutical formulations. The presence of the bromine substituent may also influence the compound's reactivity and interaction with biological targets. Overall, this compound's unique structural features suggest it may have significant implications in drug development and therapeutic applications.

Formula: C₁₁H₁₅BrN₂O₂S·ClH

InChI: InChI=1S/C11H15BrN2O2S.ClH/c12-9-3-5-11(6-4-9)17(15,16)14-7-1-2-10(13)8-14;/h3-6,10H,1-2,7-8,13H2;1H

InChI key: InChIKey=ZDBANACNZTVSSR-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=CC=C(Br)C=C1)N2CC(N)CCC2.Cl

Synonyms:

• 3-Piperidinamine, 1-[(4-bromophenyl)sulfonyl]-, hydrochloride (1:1)

1-(4-Bromobenzenesulfonyl)piperidin-3-amine hydrochloride

CAS: 1803592-16-6

Versatile small molecule scaffold

Formula: C₁₁H₁₆BrClN₂O₂S

Purity: Min. 95%

Molecular weight: 355.68 g/mol

Ref: 3D-DXC59216