CAS 1803592-57-5

Propanamide, N-[3-(4-fluorobenzoyl)-2-pyridinyl]-2,2-dimethyl-

Description:

Propanamide, N-[3-(4-fluorobenzoyl)-2-pyridinyl]-2,2-dimethyl- is a chemical compound characterized by its amide functional group, which is indicative of its potential as a polar molecule. The presence of a pyridine ring contributes to its aromatic properties, while the 4-fluorobenzoyl moiety introduces a fluorine atom, enhancing its lipophilicity and potentially influencing its biological activity. The two dimethyl groups attached to the propanamide backbone provide steric hindrance, which may affect the compound's reactivity and interaction with biological targets. This compound is likely to exhibit moderate solubility in organic solvents and may have specific applications in pharmaceuticals or agrochemicals due to its structural features. Additionally, the presence of the fluorine atom can enhance metabolic stability and bioactivity. Overall, the unique combination of functional groups and structural elements in this compound suggests potential utility in various chemical and biological applications, warranting further investigation into its properties and effects.

Formula: C₁₇H₁₇FN₂O₂

InChI: InChI=1S/C17H17FN2O2/c1-17(2,3)16(22)20-15-13(5-4-10-19-15)14(21)11-6-8-12(18)9-7-11/h4-10H,1-3H3,(H,19,20,22)

InChI key: InChIKey=XKCLQEMZRJSPEN-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(NC(C(C)(C)C)=O)N=CC=C1)C2=CC=C(F)C=C2

Synonyms:

• Propanamide, N-[3-(4-fluorobenzoyl)-2-pyridinyl]-2,2-dimethyl-
• N-[3-(4-Fluorobenzoyl)pyridin-2-yl]-2,2-dimethylpropanamide

N-[3-(4-Fluorobenzoyl)pyridin-2-yl]-2,2-dimethylpropanamide

CAS: 1803592-57-5

Versatile small molecule scaffold

Formula: C₁₇H₁₇FN₂O₂

Purity: Min. 95%

Molecular weight: 300.33 g/mol

Ref: 3D-DXC59257