CAS 1803593-46-5

Pyridine, 4-[(3-pyrrolidinyloxy)methyl]-, hydrochloride (1:2)

Description:

Pyridine, 4-[(3-pyrrolidinyloxy)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its pyridine and pyrrolidine moieties, which contribute to its unique properties. As a hydrochloride salt, it is typically soluble in water and exhibits basic characteristics due to the presence of the pyridine nitrogen. The compound features a pyrrolidinyloxy group, which may enhance its biological activity and potential applications in medicinal chemistry. Pyridine derivatives are known for their role as ligands in coordination chemistry and as intermediates in organic synthesis. The presence of the hydrochloride form indicates that it can exist as a stable salt, which is often preferred for pharmaceutical formulations due to improved solubility and stability. Additionally, the compound may exhibit specific pharmacological properties, making it of interest in drug development. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.

Formula: C₁₀H₁₄N₂O·2ClH

InChI: InChI=1S/C10H14N2O.2ClH/c1-4-11-5-2-9(1)8-13-10-3-6-12-7-10;;/h1-2,4-5,10,12H,3,6-8H2;2*1H

InChI key: InChIKey=OKWSJBBNBDBBAV-UHFFFAOYSA-N

SMILES: C(OC1CCNC1)C=2C=CN=CC2.Cl

Synonyms:

• Pyridine, 4-[(3-pyrrolidinyloxy)methyl]-, hydrochloride (1:2)

4-[(Pyrrolidin-3-yloxy)methyl]pyridine dihydrochloride

CAS: 1803593-46-5

Versatile small molecule scaffold

Formula: C₁₀H₁₆Cl₂N₂O

Purity: Min. 95%

Molecular weight: 251.15 g/mol

Ref: 3D-DXC59346