CAS 1803593-50-1

1H-Imidazole-1-propanamine, N-cyclohexyl-β-methyl-, hydrochloride (1:1)

Description:

1H-Imidazole-1-propanamine, N-cyclohexyl-β-methyl-, hydrochloride (1:1) is a chemical compound characterized by its imidazole ring structure, which contributes to its potential biological activity. This substance features a propanamine backbone with a cyclohexyl group and a β-methyl substituent, enhancing its lipophilicity and possibly influencing its interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in various applications, including pharmaceuticals. The imidazole moiety is known for its role in biological systems, often acting as a base or a ligand in coordination chemistry. The compound may exhibit properties such as antimicrobial or antifungal activity, although specific biological effects would depend on its concentration and the context of use. Safety and handling precautions are essential, as with any chemical, particularly in laboratory or industrial settings. Further studies would be necessary to fully elucidate its pharmacological profile and potential applications.

Formula: C₁₃H₂₃N₃·ClH

InChI: InChI=1S/C13H23N3.ClH/c1-12(10-16-8-7-14-11-16)9-15-13-5-3-2-4-6-13;/h7-8,11-13,15H,2-6,9-10H2,1H3;1H

InChI key: InChIKey=BUGBHOFAALYMHR-UHFFFAOYSA-N

SMILES: C(C(CNC1CCCCC1)C)N2C=CN=C2.Cl

Synonyms:

• 1H-Imidazole-1-propanamine, N-cyclohexyl-β-methyl-, hydrochloride (1:1)

N-[3-(1H-Imidazol-1-yl)-2-methylpropyl]cyclohexanamine hydrochloride

CAS: 1803593-50-1

Versatile small molecule scaffold

Formula: C₁₃H₂₄ClN₃

Purity: Min. 95%

Molecular weight: 257.8 g/mol

Ref: 3D-DXC59350