CAS 1803594-07-1

Cyclobutaneacetic acid, 3-(1,1-dimethylethoxy)-

Description:

Cyclobutaneacetic acid, 3-(1,1-dimethylethoxy)-, identified by its CAS number 1803594-07-1, is an organic compound characterized by its cyclobutane ring structure and an acetic acid functional group. The presence of the 1,1-dimethylethoxy group introduces steric hindrance, which can influence the compound's reactivity and physical properties. Typically, compounds of this nature may exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the cyclobutane ring can impart unique conformational characteristics. The compound may also participate in various chemical reactions, including esterification and acylation, due to the reactive carboxylic acid moiety. Its specific applications and behavior in chemical reactions would depend on the context of its use, such as in synthetic organic chemistry or as a potential intermediate in the production of more complex molecules. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its potential reactivity and toxicity.

Formula: C₁₀H₁₈O₃

InChI: InChI=1S/C10H18O3/c1-10(2,3)13-8-4-7(5-8)6-9(11)12/h7-8H,4-6H2,1-3H3,(H,11,12)

InChI key: InChIKey=KKAYYILOIWIYOE-UHFFFAOYSA-N

SMILES: O(C(C)(C)C)C1CC(CC(O)=O)C1

2-[3-(tert-Butoxy)cyclobutyl]acetic acid

CAS: 1803594-07-1

Versatile small molecule scaffold

Formula: C₁₀H₁₈O₃

Purity: Min. 95%

Molecular weight: 186.25 g/mol

Ref: 3D-DXC59407