CAS 1803594-54-8

Benzenamine, 3-bromo-4-(4-methyl-1-piperazinyl)-, hydrochloride (1:1)

Description:

Benzenamine, 3-bromo-4-(4-methyl-1-piperazinyl)-, hydrochloride (1:1) is a chemical compound characterized by its aromatic amine structure, which includes a bromine substituent at the 3-position and a piperazine moiety at the 4-position of the benzene ring. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceuticals. The piperazine group contributes to its potential biological activity, often associated with psychoactive properties or use in medicinal chemistry. This compound may exhibit properties such as moderate to high polarity due to the amine and piperazine functionalities, influencing its interaction with biological systems. Additionally, the bromine atom can participate in further chemical reactions, making it a versatile intermediate in organic synthesis. Safety and handling precautions are essential, as with many amines and halogenated compounds, due to potential toxicity and reactivity.

Formula: C₁₁H₁₆BrN₃·ClH

InChI: InChI=1S/C11H16BrN3.ClH/c1-14-4-6-15(7-5-14)11-3-2-9(13)8-10(11)12;/h2-3,8H,4-7,13H2,1H3;1H

InChI key: InChIKey=IRKIRSNTJRQTEZ-UHFFFAOYSA-N

SMILES: BrC1=C(N2CCN(C)CC2)C=CC(N)=C1.Cl

Synonyms:

• Benzenamine, 3-bromo-4-(4-methyl-1-piperazinyl)-, hydrochloride (1:1)

3-Bromo-4-(4-methylpiperazin-1-yl)aniline hydrochloride

CAS: 1803594-54-8

Versatile small molecule scaffold

Formula: C₁₁H₁₇BrClN₃

Purity: Min. 95%

Molecular weight: 306.63 g/mol

Ref: 3D-DXC59454