CAS 1803594-61-7

Bicyclo[3.1.0]hexan-2-one, 6-(methoxymethyl)-

Description:

Bicyclo[3.1.0]hexan-2-one, 6-(methoxymethyl)- is a bicyclic organic compound characterized by its unique bicyclic structure, which consists of a six-membered ring fused with a three-membered ring. This compound features a ketone functional group at the second position of the bicyclic framework, contributing to its reactivity and potential applications in organic synthesis. The presence of a methoxymethyl group at the sixth position enhances its chemical properties, potentially influencing its solubility and reactivity. The compound's molecular structure allows for various stereochemical configurations, which can affect its physical properties and biological activity. As a relatively specialized compound, it may be of interest in fields such as medicinal chemistry or materials science, where its unique structural features could be leveraged for the development of novel compounds or materials. Overall, Bicyclo[3.1.0]hexan-2-one, 6-(methoxymethyl)- represents a fascinating example of bicyclic chemistry with potential utility in various chemical applications.

Formula: C₈H₁₂O₂

InChI: InChI=1S/C8H12O2/c1-10-4-6-5-2-3-7(9)8(5)6/h5-6,8H,2-4H2,1H3

InChI key: InChIKey=SLKCIDSJLGFPGQ-UHFFFAOYSA-N

SMILES: C(OC)C1C2C1CCC2=O

Synonyms:

• Bicyclo[3.1.0]hexan-2-one, 6-(methoxymethyl)-
• 6-(Methoxymethyl)bicyclo[3.1.0]hexan-2-one

6-(Methoxymethyl)bicyclo[3.1.0]hexan-2-one

CAS: 1803594-61-7

Versatile small molecule scaffold

Formula: C₈H₁₂O₂

Purity: Min. 95%

Molecular weight: 140.18 g/mol

Ref: 3D-DXC59461