CAS 1803594-65-1

1-[4-(Acetyloxy)phenyl]-3-chloro-2-propanone

Description:

1-[4-(Acetyloxy)phenyl]-3-chloro-2-propanone, identified by its CAS number 1803594-65-1, is an organic compound characterized by its functional groups and structural features. It contains an acetoxy group (-OCOCH3) attached to a phenyl ring, which contributes to its reactivity and potential applications in organic synthesis. The presence of a chloro substituent on the propanone moiety enhances its electrophilic character, making it useful in various chemical reactions, such as nucleophilic substitutions. This compound is likely to exhibit moderate to high polarity due to the presence of both the acetoxy and chloro groups, influencing its solubility in polar solvents. Additionally, its structure suggests potential applications in pharmaceuticals or as an intermediate in the synthesis of more complex molecules. Safety and handling precautions should be observed, as with many chlorinated organic compounds, due to potential toxicity and environmental concerns. Overall, 1-[4-(Acetyloxy)phenyl]-3-chloro-2-propanone is a versatile compound with significant implications in synthetic organic chemistry.

Formula: C₁₁H₁₁ClO₃

InChI: InChI=1S/C11H11ClO3/c1-8(13)15-11-4-2-9(3-5-11)6-10(14)7-12/h2-5H,6-7H2,1H3

InChI key: InChIKey=DDQXKKRFTXRZSC-UHFFFAOYSA-N

SMILES: C(C(CCl)=O)C1=CC=C(OC(C)=O)C=C1

Synonyms:

• 2-Propanone, 1-[4-(acetyloxy)phenyl]-3-chloro-
• 1-[4-(Acetyloxy)phenyl]-3-chloro-2-propanone

4-(3-Chloro-2-oxopropyl)phenyl acetate

CAS: 1803594-65-1

Versatile small molecule scaffold

Formula: C₁₁H₁₁ClO₃

Purity: Min. 95%

Molecular weight: 226.65 g/mol

Ref: 3D-DXC59465