CAS 1803594-95-7

1H-Indole, 2,3-dihydro-5-methyl-, hydrochloride (1:1)

Description:

1H-Indole, 2,3-dihydro-5-methyl-, hydrochloride (1:1) is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. The "2,3-dihydro" designation indicates that the compound has two additional hydrogen atoms, resulting in a saturated form of the indole. The "5-methyl" refers to a methyl group attached to the fifth carbon of the indole ring, influencing its chemical properties and reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including pharmaceuticals and research. The compound may exhibit biological activity, making it of interest in medicinal chemistry. Its CAS number, 1803594-95-7, uniquely identifies this specific compound in chemical databases, facilitating its study and application in various scientific fields.

Formula: C₉H₁₁N·ClH

InChI: InChI=1S/C9H11N.ClH/c1-7-2-3-9-8(6-7)4-5-10-9;/h2-3,6,10H,4-5H2,1H3;1H

InChI key: InChIKey=HUZRPGWQUGLMPD-UHFFFAOYSA-N

SMILES: CC=1C=C2C(=CC1)NCC2.Cl

Synonyms:

• 1H-Indole, 2,3-dihydro-5-methyl-, hydrochloride (1:1)

5-Methylindoline hydrochloride

CAS: 1803594-95-7

Versatile small molecule scaffold

Formula: C₉H₁₂ClN

Purity: Min. 95%

Molecular weight: 169.65 g/mol

Ref: 3D-DXC59495