CAS 1803595-17-6

1,1-Dimethylethyl 2-[bis(cyanomethyl)amino]-2-oxoacetate

Description:

1,1-Dimethylethyl 2-[bis(cyanomethyl)amino]-2-oxoacetate, identified by its CAS number 1803595-17-6, is a chemical compound that features a complex structure characterized by the presence of a dimethyl group, a bis(cyanomethyl)amino group, and an ester functional group. This compound is likely to exhibit properties typical of both amines and esters, including potential reactivity due to the presence of the cyanomethyl groups, which can participate in nucleophilic reactions. The oxoacetate moiety suggests that it may also engage in reactions typical of carbonyl compounds, such as condensation or addition reactions. The presence of multiple functional groups indicates that this compound could be of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals. Additionally, its unique structure may impart specific physical properties, such as solubility in organic solvents and potential biological activity, although detailed studies would be necessary to fully characterize its behavior and applications.

Formula: C₁₀H₁₃N₃O₃

InChI: InChI=1S/C10H13N3O3/c1-10(2,3)16-9(15)8(14)13(6-4-11)7-5-12/h6-7H2,1-3H3

InChI key: InChIKey=FFTRIWLWQHCGND-UHFFFAOYSA-N

SMILES: N(C(C(OC(C)(C)C)=O)=O)(CC#N)CC#N

Synonyms:

• Acetic acid, 2-[bis(cyanomethyl)amino]-2-oxo-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 2-[bis(cyanomethyl)amino]-2-oxoacetate

tert-Butyl [bis(cyanomethyl)carbamoyl]formate

CAS: 1803595-17-6

Versatile small molecule scaffold

Formula: C₁₀H₁₃N₃O₃

Purity: Min. 95%

Molecular weight: 223.23 g/mol

Ref: 3D-DXC59517