CAS 1803595-53-0

1-Propanone, 1-(3,5-dimethyl-1-piperazinyl)-2,2-dimethyl-, hydrochloride (1:1)

Description:

1-Propanone, 1-(3,5-dimethyl-1-piperazinyl)-2,2-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its piperazine moiety, which contributes to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the propanone functional group suggests it may participate in various chemical reactions, including nucleophilic additions. The dimethyl substitutions on the piperazine ring can influence the compound's steric and electronic properties, potentially affecting its interaction with biological targets. This compound may exhibit psychoactive or therapeutic properties, given the structural features common in piperazine derivatives. Its molecular structure suggests it could be of interest in medicinal chemistry, particularly in the development of drugs targeting the central nervous system. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its pharmacological profile and applications.

Formula: C₁₁H₂₂N₂O·ClH

InChI: InChI=1S/C11H22N2O.ClH/c1-8-6-13(7-9(2)12-8)10(14)11(3,4)5;/h8-9,12H,6-7H2,1-5H3;1H

InChI key: InChIKey=HAPPVNVCCQVGGB-UHFFFAOYSA-N

SMILES: C(C(C)(C)C)(=O)N1CC(C)NC(C)C1.Cl

Synonyms:

• 1-Propanone, 1-(3,5-dimethyl-1-piperazinyl)-2,2-dimethyl-, hydrochloride (1:1)

1-(3,5-Dimethylpiperazin-1-yl)-2,2-dimethylpropan-1-one hydrochloride

CAS: 1803595-53-0

Versatile small molecule scaffold

Formula: C₁₁H₂₃ClN₂O

Purity: Min. 95%

Molecular weight: 234.76 g/mol

Ref: 3D-DXC59553