CAS 1803596-25-9

Ethanone, 2-(hexahydro-1H-azepin-4-yl)-1-(1-pyrrolidinyl)-, hydrochloride (1:1)

Description:

Ethanone, 2-(hexahydro-1H-azepin-4-yl)-1-(1-pyrrolidinyl)-, hydrochloride (1:1), with the CAS number 1803596-25-9, is a chemical compound characterized by its complex structure, which includes a hexahydroazepine and a pyrrolidine moiety. This compound is typically classified as a hydrochloride salt, indicating that it is a protonated form of the base compound, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The presence of the azepine and pyrrolidine rings suggests potential biological activity, possibly influencing central nervous system functions or acting as a neurotransmitter modulator. The compound's molecular structure may contribute to its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion. As with many synthetic organic compounds, safety and handling precautions are essential, as the biological effects and toxicity profiles would need to be thoroughly evaluated in a laboratory setting. Overall, this compound represents a specific class of organic molecules with potential therapeutic applications.

Formula: C₁₂H₂₂N₂O·ClH

InChI: InChI=1S/C12H22N2O.ClH/c15-12(14-8-1-2-9-14)10-11-4-3-6-13-7-5-11;/h11,13H,1-10H2;1H

InChI key: InChIKey=KOKVURVPCHBVBF-UHFFFAOYSA-N

SMILES: C(C(=O)N1CCCC1)C2CCCNCC2.Cl

Synonyms:

• Ethanone, 2-(hexahydro-1H-azepin-4-yl)-1-(1-pyrrolidinyl)-, hydrochloride (1:1)

2-(Azepan-4-yl)-1-(pyrrolidin-1-yl)ethan-1-one hydrochloride

CAS: 1803596-25-9

Versatile small molecule scaffold

Formula: C₁₂H₂₃ClN₂O

Purity: Min. 95%

Molecular weight: 246.78 g/mol

Ref: 3D-DXC59625