CAS 1803596-45-3

1-Propanone, 2-chloro-1-[4-(2-pyridinyl)-1-piperazinyl]-, hydrochloride (1:1)

Description:

1-Propanone, 2-chloro-1-[4-(2-pyridinyl)-1-piperazinyl]-, hydrochloride (1:1), with CAS number 1803596-45-3, is a chemical compound characterized by its structural features that include a propanone backbone, a chloro substituent, and a piperazine moiety linked to a pyridine ring. This compound typically appears as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications, particularly in pharmaceutical contexts. The presence of the piperazine and pyridine groups suggests potential biological activity, possibly influencing neurotransmitter systems or serving as a scaffold for drug development. Its molecular structure indicates that it may exhibit properties such as moderate polarity and the ability to form hydrogen bonds, which can affect its interaction with biological targets. Additionally, the hydrochloride form often indicates stability and ease of handling in laboratory settings. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as well as for any specific regulatory considerations.

Formula: C₁₂H₁₆ClN₃O·ClH

InChI: InChI=1S/C12H16ClN3O.ClH/c1-10(13)12(17)16-8-6-15(7-9-16)11-4-2-3-5-14-11;/h2-5,10H,6-9H2,1H3;1H

InChI key: InChIKey=PSNJFQISSQSXCF-UHFFFAOYSA-N

SMILES: C(C(C)Cl)(=O)N1CCN(CC1)C2=CC=CC=N2.Cl

Synonyms:

• 1-Propanone, 2-chloro-1-[4-(2-pyridinyl)-1-piperazinyl]-, hydrochloride (1:1)

2-Chloro-1-[4-(pyridin-2-yl)piperazin-1-yl]propan-1-one hydrochloride

CAS: 1803596-45-3

Versatile small molecule scaffold

Formula: C₁₂H₁₇Cl₂N₃O

Purity: Min. 95%

Molecular weight: 290.19 g/mol

Ref: 3D-DXC59645