CAS 1803596-57-7

1,1-Dimethylethyl N-[(1-formylcyclobutyl)methyl]carbamate

Description:

1,1-Dimethylethyl N-[(1-formylcyclobutyl)methyl]carbamate, identified by its CAS number 1803596-57-7, is a chemical compound that belongs to the class of carbamates. This substance features a carbamate functional group, which is characterized by the presence of a carbonyl group (C=O) attached to a nitrogen atom (N) that is also bonded to an alkyl or aryl group. The compound includes a dimethyl group, indicating the presence of two methyl groups attached to a tertiary carbon, which contributes to its steric bulk. Additionally, the presence of a formylcyclobutyl moiety suggests that it has a cyclic structure with a formyl group (–CHO) that can influence its reactivity and potential applications. The unique combination of these structural features may impart specific physical and chemical properties, such as solubility, stability, and reactivity, making it of interest in various fields, including organic synthesis and medicinal chemistry. However, detailed studies would be necessary to fully understand its behavior and potential uses.

Formula: C₁₁H₁₉NO₃

InChI: InChI=1S/C11H19NO3/c1-10(2,3)15-9(14)12-7-11(8-13)5-4-6-11/h8H,4-7H2,1-3H3,(H,12,14)

InChI key: InChIKey=IJLNNGPCNJWBMU-UHFFFAOYSA-N

SMILES: C(NC(OC(C)(C)C)=O)C1(C=O)CCC1

Synonyms:

• tert-Butyl N-[(1-formylcyclobutyl)methyl]carbamate
• 1,1-Dimethylethyl N-[(1-formylcyclobutyl)methyl]carbamate
• Carbamic acid, N-[(1-formylcyclobutyl)methyl]-, 1,1-dimethylethyl ester

tert-Butyl N-[(1-formylcyclobutyl)methyl]carbamate

CAS: 1803596-57-7

Versatile small molecule scaffold

Formula: C₁₁H₁₉NO₃

Purity: Min. 95%

Molecular weight: 213.27 g/mol

Ref: 3D-DXC59657