CAS 1803596-65-7

3-Azetidinecarboxylic acid, 3-fluoro-, ethyl ester, hydrochloride (1:1)

Description:

3-Azetidinecarboxylic acid, 3-fluoro-, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered cyclic amine. The presence of a carboxylic acid functional group and a fluoro substituent at the 3-position of the azetidine ring contributes to its reactivity and potential biological activity. As an ethyl ester, it features an ethyl group attached to the carboxylic acid, which can influence its solubility and pharmacokinetic properties. The hydrochloride salt form indicates that the compound is protonated, enhancing its stability and solubility in aqueous environments, which is often advantageous for pharmaceutical applications. This compound may exhibit interesting properties due to the combination of its azetidine framework and the fluorine atom, which can affect its electronic characteristics and interactions with biological targets. Overall, this compound's unique structure suggests potential utility in medicinal chemistry, particularly in the development of novel therapeutic agents.

Formula: C₆H₁₀FNO₂·ClH

InChI: InChI=1S/C6H10FNO2.ClH/c1-2-10-5(9)6(7)3-8-4-6;/h8H,2-4H2,1H3;1H

InChI key: InChIKey=SLVLBPMBTDPVCY-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1(F)CNC1.Cl

Synonyms:

• 3-Azetidinecarboxylic acid, 3-fluoro-, ethyl ester, hydrochloride (1:1)

Ethyl 3-fluoroazetidine-3-carboxylate hydrochloride

CAS: 1803596-65-7

Versatile small molecule scaffold

Formula: C₆H₁₁ClFNO₂

Purity: Min. 95%

Molecular weight: 183.61 g/mol

Ref: 3D-DXC59665