CAS 1803596-68-0

9H-Purine, 6-(hexahydro-1H-1,4-diazepin-1-yl)-, hydrochloride (1:3)

Description:

9H-Purine, 6-(hexahydro-1H-1,4-diazepin-1-yl)-, hydrochloride (1:3) is a chemical compound characterized by its purine base structure, which is a fundamental component of nucleic acids. The presence of a hexahydro-1H-1,4-diazepin moiety indicates that it contains a saturated nitrogen-containing heterocyclic ring, contributing to its biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its potential for pharmaceutical applications. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of drugs targeting various biological pathways. Its molecular structure suggests potential interactions with biological macromolecules, such as enzymes or receptors, which could be explored for therapeutic purposes. The specific characteristics, such as melting point, solubility, and stability, would depend on the conditions under which the compound is handled and stored. Further studies would be necessary to elucidate its pharmacological profile and potential applications in drug development.

Formula: C₁₀H₁₄N₆·3ClH

InChI: InChI=1S/C10H14N6.3ClH/c1-2-11-3-5-16(4-1)10-8-9(13-6-12-8)14-7-15-10;;;/h6-7,11H,1-5H2,(H,12,13,14,15);3*1H

InChI key: InChIKey=NOZDSZSTMVRTQN-UHFFFAOYSA-N

SMILES: C12=C(N=CN=C1N=CN2)N3CCCNCC3.Cl

Synonyms:

• 9H-Purine, 6-(hexahydro-1H-1,4-diazepin-1-yl)-, hydrochloride (1:3)

6-(1,4-Diazepan-1-yl)-9H-purine trihydrochloride

CAS: 1803596-68-0

Versatile small molecule scaffold

Formula: C₁₀H₁₇Cl₃N₆

Purity: Min. 95%

Molecular weight: 327.6 g/mol

Ref: 3D-DXC59668