CAS 1803596-71-5

5-Pyrimidinemethanamine, 4-amino-2-(methoxymethyl)-, hydrochloride (1:2)

Description:

5-Pyrimidinemethanamine, 4-amino-2-(methoxymethyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features an amino group and a methoxymethyl substituent, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the amino group suggests potential for interactions with biological targets, making it of interest in medicinal chemistry. The compound's molecular structure may influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion. Additionally, the specific arrangement of functional groups can affect its reactivity and stability under various conditions. Overall, this compound's unique characteristics position it as a candidate for further research in drug development and related fields.

Formula: C₇H₁₂N₄O·2ClH

InChI: InChI=1S/C7H12N4O.2ClH/c1-12-4-6-10-3-5(2-8)7(9)11-6;;/h3H,2,4,8H2,1H3,(H2,9,10,11);2*1H

InChI key: InChIKey=XQVAQAIQGQTUGA-UHFFFAOYSA-N

SMILES: C(OC)C=1N=C(N)C(CN)=CN1.Cl

Synonyms:

• 5-Pyrimidinemethanamine, 4-amino-2-(methoxymethyl)-, hydrochloride (1:2)

5-(Aminomethyl)-2-(methoxymethyl)pyrimidin-4-amine dihydrochloride

CAS: 1803596-71-5

Versatile small molecule scaffold

Formula: C₇H₁₄Cl₂N₄O

Purity: Min. 95%

Molecular weight: 241.12 g/mol

Ref: 3D-DXC59671