CAS 1803596-96-4

Pyrrolidine, 1-(3-azidopropyl)-, hydrochloride (1:1)

Description:

Pyrrolidine, 1-(3-azidopropyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated nitrogen-containing heterocycle. The presence of the azidopropyl group indicates that it has an azide functional group (-N3) attached to a propyl chain, which can impart unique reactivity, particularly in click chemistry and other synthetic applications. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various chemical reactions and biological applications. The compound may exhibit properties such as being a potential intermediate in organic synthesis or a building block for more complex molecules. Safety considerations are important due to the presence of the azide group, which can be sensitive and potentially explosive under certain conditions. Overall, this compound is of interest in medicinal chemistry and materials science, where its unique structural features can be leveraged for innovative applications.

Formula: C₇H₁₄N₄·ClH

InChI: InChI=1S/C7H14N4.ClH/c8-10-9-4-3-7-11-5-1-2-6-11;/h1-7H2;1H

InChI key: InChIKey=QILRPESUGKSTBT-UHFFFAOYSA-N

SMILES: C(CCN=[N+]=[N-])N1CCCC1.Cl

Synonyms:

• Pyrrolidine, 1-(3-azidopropyl)-, hydrochloride (1:1)

1-(3-Azidopropyl)pyrrolidine hydrochloride

CAS: 1803596-96-4

Versatile small molecule scaffold

Formula: C₇H₁₅ClN₄

Purity: Min. 95%

Molecular weight: 190.67 g/mol

Ref: 3D-DXC59696