CAS 1803597-14-9

Piperidine, 2-(bromomethyl)-1-(1-methylethyl)-, hydrobromide (1:1)

Description:

Piperidine, 2-(bromomethyl)-1-(1-methylethyl)-, hydrobromide (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a bromomethyl group at the 2-position and an isopropyl group at the 1-position contributes to its unique properties. As a hydrobromide salt, it is typically encountered in a crystalline form and is soluble in polar solvents, such as water and alcohols. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its molecular structure suggests potential reactivity due to the bromomethyl group, which can participate in nucleophilic substitution reactions. The hydrobromide form enhances its stability and solubility, facilitating its use in various chemical applications. Safety data should be consulted, as halogenated compounds can pose health risks, including toxicity and environmental concerns. Overall, this compound's characteristics make it a subject of interest for further research and application in synthetic organic chemistry.

Formula: C₉H₁₈BrN·BrH

InChI: InChI=1S/C9H18BrN.BrH/c1-8(2)11-6-4-3-5-9(11)7-10;/h8-9H,3-7H2,1-2H3;1H

InChI key: InChIKey=KKRGMWWQOQRXCK-UHFFFAOYSA-N

SMILES: C(Br)C1N(C(C)C)CCCC1.Br

Synonyms:

• Piperidine, 2-(bromomethyl)-1-(1-methylethyl)-, hydrobromide (1:1)

2-(Bromomethyl)-1-(propan-2-yl)piperidine hydrobromide

CAS: 1803597-14-9

Versatile small molecule scaffold

Formula: C₉H₁₉Br₂N

Purity: Min. 95%

Molecular weight: 301.06 g/mol

Ref: 3D-DXC59714