CAS 1803597-24-1

Benzenesulfonamide, N-(3-aminobutyl)-, hydrochloride (1:1)

Description:

Benzenesulfonamide, N-(3-aminobutyl)-, hydrochloride (1:1) is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a benzenesulfonamide moiety linked to a 3-aminobutyl chain, indicating the presence of an amine group that can participate in various chemical reactions. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability for pharmaceutical applications. The compound may exhibit properties such as moderate to high melting points and stability under standard laboratory conditions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting bacterial infections or other therapeutic areas. Additionally, the presence of the amine group may allow for further derivatization, making it a versatile intermediate in organic synthesis. Safety and handling precautions should be observed, as with all sulfonamide derivatives, due to potential allergic reactions in sensitive individuals.

Formula: C₁₀H₁₆N₂O₂S·ClH

InChI: InChI=1S/C10H16N2O2S.ClH/c1-9(11)7-8-12-15(13,14)10-5-3-2-4-6-10;/h2-6,9,12H,7-8,11H2,1H3;1H

InChI key: InChIKey=QWRMILGLYLKTRP-UHFFFAOYSA-N

SMILES: S(NCCC(C)N)(=O)(=O)C1=CC=CC=C1.Cl

Synonyms:

• Benzenesulfonamide, N-(3-aminobutyl)-, hydrochloride (1:1)

N-(3-Aminobutyl)benzenesulfonamide hydrochloride

CAS: 1803597-24-1

Versatile small molecule scaffold

Formula: C₁₀H₁₇ClN₂O₂S

Purity: Min. 95%

Molecular weight: 264.77 g/mol

Ref: 3D-DXC59724