CAS 1803598-47-1

Benzenemethanamine, 2-(1-methylethyl)-, hydrochloride (1:1)

Description:

Benzenemethanamine, 2-(1-methylethyl)-, hydrochloride (1:1), also known as a specific amine derivative, is characterized by its structural features that include a benzene ring attached to a methanamine group, with an isopropyl substituent at the second carbon. This compound typically appears as a white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The amine functional group contributes to its basicity, allowing it to participate in various chemical reactions, such as alkylation and acylation. Its hydrochloride form is commonly used in pharmaceutical applications, where it may serve as an intermediate in the synthesis of biologically active compounds. Safety data indicates that, like many amines, it should be handled with care due to potential irritant properties. Overall, this compound's unique structure and properties make it of interest in both synthetic organic chemistry and medicinal chemistry contexts.

Formula: C₁₀H₁₅N·ClH

InChI: InChI=1S/C10H15N.ClH/c1-8(2)10-6-4-3-5-9(10)7-11;/h3-6,8H,7,11H2,1-2H3;1H

InChI key: InChIKey=XYNPIINVKGTHFE-UHFFFAOYSA-N

SMILES: C(N)C1=C(C(C)C)C=CC=C1.Cl

Synonyms:

• Benzenemethanamine, 2-(1-methylethyl)-, hydrochloride (1:1)

1-[2-(Propan-2-yl)phenyl]methanamine hydrochloride

CAS: 1803598-47-1

Versatile small molecule scaffold

Formula: C₁₀H₁₆ClN

Purity: Min. 95%

Molecular weight: 185.69 g/mol

Ref: 3D-DXC59847