CAS 1803598-94-8

Piperidine, 4-fluoro-4-[2-(trifluoromethoxy)phenyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-fluoro-4-[2-(trifluoromethoxy)phenyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a fluorine atom at the 4-position of the piperidine ring and a trifluoromethoxy group attached to a phenyl ring significantly influences its chemical properties and reactivity. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in polar solvents, making it suitable for various applications in medicinal chemistry and drug development. The trifluoromethoxy group contributes to the compound's lipophilicity and potential biological activity, while the fluorine substituents can affect its pharmacokinetic properties. As with many fluorinated compounds, it may exhibit unique interactions with biological targets, potentially leading to enhanced efficacy or altered side effects in therapeutic contexts. Safety and handling precautions are essential due to the presence of fluorinated groups, which can pose environmental and health risks.

Formula: C₁₂H₁₃F₄NO·ClH

InChI: InChI=1S/C12H13F4NO.ClH/c13-11(5-7-17-8-6-11)9-3-1-2-4-10(9)18-12(14,15)16;/h1-4,17H,5-8H2;1H

InChI key: InChIKey=XKVOOBVAHKPDAW-UHFFFAOYSA-N

SMILES: FC1(C2=C(OC(F)(F)F)C=CC=C2)CCNCC1.Cl

Synonyms:

• Piperidine, 4-fluoro-4-[2-(trifluoromethoxy)phenyl]-, hydrochloride (1:1)

4-Fluoro-4-[2-(trifluoromethoxy)phenyl]piperidine hydrochloride

CAS: 1803598-94-8

Versatile small molecule scaffold

Formula: C₁₂H₁₄ClF₄NO

Purity: Min. 95%

Molecular weight: 299.69 g/mol

Ref: 3D-DXC59894