CAS 1803599-09-8

Butanamide, 4-amino-3-methoxy-, hydrochloride (1:1)

Description:

Butanamide, 4-amino-3-methoxy-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from butanoic acid. The presence of an amino group at the 4-position and a methoxy group at the 3-position on the butanamide backbone contributes to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its potential applications in biological systems. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests that it could participate in hydrogen bonding due to the amide and amino functionalities, influencing its reactivity and interaction with other molecules. The compound's stability, solubility, and potential pharmacological effects would be important considerations in its application, particularly in medicinal chemistry. Overall, Butanamide, 4-amino-3-methoxy-, hydrochloride (1:1) represents a specific class of organic compounds with potential utility in various chemical and biological contexts.

Formula: C₅H₁₂N₂O₂·ClH

InChI: InChI=1S/C5H12N2O2.ClH/c1-9-4(3-6)2-5(7)8;/h4H,2-3,6H2,1H3,(H2,7,8);1H

InChI key: InChIKey=ZSHYUPONHOKWJC-UHFFFAOYSA-N

SMILES: C(CC(N)=O)(CN)OC.Cl

Synonyms:

• Butanamide, 4-amino-3-methoxy-, hydrochloride (1:1)

4-Amino-3-methoxybutanamide hydrochloride

CAS: 1803599-09-8

Versatile small molecule scaffold

Formula: C₅H₁₃ClN₂O₂

Purity: Min. 95%

Molecular weight: 168.62 g/mol

Ref: 3D-DXC59909