CAS 1803599-38-3

2H-Thiopyran-4-amine, tetrahydro-N-(2,2,2-trifluoroethyl)-, 1,1-dioxide, hydrochloride (1:1)

Description:

2H-Thiopyran-4-amine, tetrahydro-N-(2,2,2-trifluoroethyl)-, 1,1-dioxide, hydrochloride (1:1) is a chemical compound characterized by its unique thiopyran ring structure, which incorporates a nitrogen atom and a sulfur atom within a six-membered ring. The presence of the tetrahydro-N-(2,2,2-trifluoroethyl) group suggests that it has significant steric and electronic properties due to the trifluoroethyl substituent, which can influence its reactivity and interactions with biological targets. The compound is also a hydrochloride salt, indicating that it is likely soluble in water and may exhibit different properties compared to its free base form. As a 1,1-dioxide, it features two oxygen atoms double-bonded to the sulfur atom, which can enhance its stability and reactivity. This compound may have potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological systems. However, specific biological activity, toxicity, and pharmacokinetic properties would require further investigation.

Formula: C₇H₁₂F₃NO₂S·ClH

InChI: InChI=1S/C7H12F3NO2S.ClH/c8-7(9,10)5-11-6-1-3-14(12,13)4-2-6;/h6,11H,1-5H2;1H

InChI key: InChIKey=GFKHKYVEDJFHHY-UHFFFAOYSA-N

SMILES: N(CC(F)(F)F)C1CCS(=O)(=O)CC1.Cl

Synonyms:

• 2H-Thiopyran-4-amine, tetrahydro-N-(2,2,2-trifluoroethyl)-, 1,1-dioxide, hydrochloride (1:1)

4-[(2,2,2-Trifluoroethyl)amino]-1λ⁶-thiane-1,1-dione hydrochloride

CAS: 1803599-38-3

Versatile small molecule scaffold

Formula: C₇H₁₃ClF₃NO₂S

Purity: Min. 95%

Molecular weight: 267.7 g/mol

Ref: 3D-DXC59938