CAS 1803599-80-5

Methanone, [2-(1-aminoethyl)-4-morpholinyl](2,3-dichlorophenyl)-, hydrochloride (1:1)

Description:

Methanone, [2-(1-aminoethyl)-4-morpholinyl](2,3-dichlorophenyl)-, hydrochloride (1:1), identified by CAS number 1803599-80-5, is a chemical compound characterized by its complex structure that includes a morpholine ring and a dichlorophenyl group. This compound typically exhibits properties associated with both amines and ketones, which may influence its reactivity and interactions in biological systems. The presence of the hydrochloride indicates that it is a salt form, which often enhances solubility in water and may affect its pharmacokinetic properties. The morpholine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as morpholine derivatives are known for their biological activity. The dichlorophenyl group may contribute to the compound's lipophilicity and overall stability. As with many compounds of this nature, understanding its characteristics requires consideration of its molecular interactions, potential therapeutic effects, and safety profile in various applications. Further studies would be necessary to elucidate its specific biological activities and mechanisms of action.

Formula: C₁₃H₁₆Cl₂N₂O₂·ClH

InChI: InChI=1S/C13H16Cl2N2O2.ClH/c1-8(16)11-7-17(5-6-19-11)13(18)9-3-2-4-10(14)12(9)15;/h2-4,8,11H,5-7,16H2,1H3;1H

InChI key: InChIKey=XFNPCDNFGDVKDH-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)C(Cl)=CC=C1)N2CC(C(C)N)OCC2.Cl

Synonyms:

• Methanone, [2-(1-aminoethyl)-4-morpholinyl](2,3-dichlorophenyl)-, hydrochloride (1:1)

1-[4-(2,3-Dichlorobenzoyl)morpholin-2-yl]ethan-1-amine hydrochloride

CAS: 1803599-80-5

Versatile small molecule scaffold

Formula: C₁₃H₁₇Cl₃N₂O₂

Purity: Min. 95%

Molecular weight: 339.6 g/mol

Ref: 3D-DXC59980