CAS 1803600-06-7

2H-Pyran-4-carboxylic acid, 4-bromotetrahydro-

Description:

2H-Pyran-4-carboxylic acid, 4-bromotetrahydro- is a chemical compound characterized by its pyran ring structure, which is a six-membered heterocyclic compound containing one oxygen atom. This substance features a carboxylic acid functional group, which contributes to its acidity and reactivity. The presence of a bromine atom at the 4-position of the tetrahydro-pyran structure introduces unique properties, such as increased electrophilicity and potential for further chemical transformations. The compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the bromine substituent may influence its reactivity in nucleophilic substitution reactions. Additionally, the compound may have applications in organic synthesis, medicinal chemistry, or as an intermediate in the production of more complex molecules. Its specific physical and chemical properties, such as melting point, boiling point, and spectral characteristics, would typically be determined through experimental methods or detailed literature references.

Formula: C₆H₉BrO₃

InChI: InChI=1S/C6H9BrO3/c7-6(5(8)9)1-3-10-4-2-6/h1-4H2,(H,8,9)

InChI key: InChIKey=QEOPAXDMQKLKCF-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(Br)CCOCC1

Synonyms:

• 2H-Pyran-4-carboxylic acid, 4-bromotetrahydro-
• 4-Bromotetrahydro-2H-pyran-4-carboxylic acid

4-Bromooxane-4-carboxylic acid

CAS: 1803600-06-7

Versatile small molecule scaffold

Formula: C₆H₉BrO₃

Purity: Min. 95%

Molecular weight: 209.04 g/mol

Ref: 3D-DXC60006